C19H19F3N4O3 — CID 168912878
methyl 2-[4-[(2S,6R)-6-ethynyl-4-hydroxy-4-[4-(trifluoromethyl)phenyl]piperidin-2-yl]triazol-1-yl]acetate (PubChem CID 168912878) has the molecular formula C19H19F3N4O3 and a molecular weight of 408.38 g/mol. Its IUPAC name is methyl 2-[4-[(2S,6R)-6-ethynyl-4-hydroxy-4-[4-(trifluoromethyl)phenyl]piperidin-2-yl]triazol-1-yl]acetate.
| Compound Name | methyl 2-[4-[(2S,6R)-6-ethynyl-4-hydroxy-4-[4-(trifluoromethyl)phenyl]piperidin-2-yl]triazol-1-yl]acetate |
|---|---|
| PubChem CID | 168912878 |
| Molecular Formula | C19H19F3N4O3 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | methyl 2-[4-[(2S,6R)-6-ethynyl-4-hydroxy-4-[4-(trifluoromethyl)phenyl]piperidin-2-yl]triazol-1-yl]acetate |
| SMILES | C#C[C@H]1CC(O)(c2ccc(C(F)(F)F)cc2)C[C@@H](c2cn(CC(=O)OC)nn2)N1 |
| InChI | InChI=1S/C19H19F3N4O3/c1-3-14-8-18(28,12-4-6-13(7-5-12)19(20,21)22)9-15(23-14)16-10-26(25-24-16)11-17(27)29-2/h1,4-7,10,14-15,23,28H,8-9,11H2,2H3/t14-,15-,18?/m0/s1 |
| InChIKey | MTPPWRBABSKPCH-INHRHCAVSA-N |
| XLogP | 1.78 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|