C26H24FN6O2 — CID 168914210
CID 168914210 (PubChem CID 168914210) has the molecular formula C26H24FN6O2 and a molecular weight of 471.52 g/mol.
| Compound Name | CID 168914210 |
|---|---|
| PubChem CID | 168914210 |
| Molecular Formula | C26H24FN6O2 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | — |
| SMILES | O=C(Nc1ccc(C2=NCCN2)cc1)c1ccc(C(=O)NC2=C[CH]C(C3=NCCN3)C=C2)c(F)c1 |
| InChI | InChI=1S/C26H24FN6O2/c27-22-15-18(25(34)32-19-6-1-16(2-7-19)23-28-11-12-29-23)5-10-21(22)26(35)33-20-8-3-17(4-9-20)24-30-13-14-31-24/h1-10,15,17H,11-14H2,(H,28,29)(H,30,31)(H,32,34)(H,33,35) |
| InChIKey | DEDHMNARABLIFC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |