C28H30N4O4 — CID 168919304
(1R,9E)-3-amino-15,25-dioxa-2,4,19-triazahexacyclo[19.6.2.22,5.211,14.013,18.024,28]tritriaconta-3,9,11,13,21(29),22,24(28),30-octaene-20,33-dione (PubChem CID 168919304) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is (1R,9E)-3-amino-15,25-dioxa-2,4,19-triazahexacyclo[19.6.2.22,5.211,14.013,18.024,28]tritriaconta-3,9,11,13,21(29),22,24(28),30-octaene-20,33-dione.
| Compound Name | (1R,9E)-3-amino-15,25-dioxa-2,4,19-triazahexacyclo[19.6.2.22,5.211,14.013,18.024,28]tritriaconta-3,9,11,13,21(29),22,24(28),30-octaene-20,33-dione |
|---|---|
| PubChem CID | 168919304 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | (1R,9E)-3-amino-15,25-dioxa-2,4,19-triazahexacyclo[19.6.2.22,5.211,14.013,18.024,28]tritriaconta-3,9,11,13,21(29),22,24(28),30-octaene-20,33-dione |
| SMILES | NC1=NC2CCC/C=C/c3ccc4c(c3)C(CCO4)NC(=O)c3ccc4c(c3)[C@@H](CCO4)N1C(=O)C2 |
| InChI | InChI=1S/C28H30N4O4/c29-28-30-19-5-3-1-2-4-17-6-8-24-20(14-17)22(10-12-35-24)31-27(34)18-7-9-25-21(15-18)23(11-13-36-25)32(28)26(33)16-19/h2,4,6-9,14-15,19,22-23H,1,3,5,10-13,16H2,(H2,29,30)(H,31,34)/b4-2+/t19?,22?,23-/m1/s1 |
| InChIKey | BYRJIKNWLFMQFA-FIQZOLHHSA-N |
| XLogP | 3.88 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |