C27H30N4O3 — CID 168918951
(1R)-3-amino-23-oxa-2,4,17-triazahexacyclo[17.6.2.22,5.210,13.012,16.022,26]hentriaconta-3,10,12,19(27),20,22(26),28-heptaene-18,31-dione (PubChem CID 168918951) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is (1R)-3-amino-23-oxa-2,4,17-triazahexacyclo[17.6.2.22,5.210,13.012,16.022,26]hentriaconta-3,10,12,19(27),20,22(26),28-heptaene-18,31-dione.
| Compound Name | (1R)-3-amino-23-oxa-2,4,17-triazahexacyclo[17.6.2.22,5.210,13.012,16.022,26]hentriaconta-3,10,12,19(27),20,22(26),28-heptaene-18,31-dione |
|---|---|
| PubChem CID | 168918951 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (1R)-3-amino-23-oxa-2,4,17-triazahexacyclo[17.6.2.22,5.210,13.012,16.022,26]hentriaconta-3,10,12,19(27),20,22(26),28-heptaene-18,31-dione |
| SMILES | NC1=NC2CCCCc3ccc4c(c3)C(CC4)NC(=O)c3ccc4c(c3)[C@@H](CCO4)N1C(=O)C2 |
| InChI | InChI=1S/C27H30N4O3/c28-27-29-19-4-2-1-3-16-5-6-17-7-9-22(20(17)13-16)30-26(33)18-8-10-24-21(14-18)23(11-12-34-24)31(27)25(32)15-19/h5-6,8,10,13-14,19,22-23H,1-4,7,9,11-12,15H2,(H2,28,29)(H,30,33)/t19?,22?,23-/m1/s1 |
| InChIKey | XNRTYLXGYIRYEL-ZUEZHPSSSA-N |
| XLogP | 3.57 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |