C29H38N4O3 — CID 176564740
11-amino-23,23-dimethyl-22-oxa-2,10,12-triazapentacyclo[16.6.2.210,13.14,8.021,25]nonacosa-4,6,8(29),11,18(26),19,21(25)-heptaene-3,28-dione;ethane (PubChem CID 176564740) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is 11-amino-23,23-dimethyl-22-oxa-2,10,12-triazapentacyclo[16.6.2.210,13.14,8.021,25]nonacosa-4,6,8(29),11,18(26),19,21(25)-heptaene-3,28-dione;ethane.
| Compound Name | 11-amino-23,23-dimethyl-22-oxa-2,10,12-triazapentacyclo[16.6.2.210,13.14,8.021,25]nonacosa-4,6,8(29),11,18(26),19,21(25)-heptaene-3,28-dione;ethane |
|---|---|
| PubChem CID | 176564740 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 11-amino-23,23-dimethyl-22-oxa-2,10,12-triazapentacyclo[16.6.2.210,13.14,8.021,25]nonacosa-4,6,8(29),11,18(26),19,21(25)-heptaene-3,28-dione;ethane |
| SMILES | CC.CC1(C)CC2NC(=O)c3cccc(c3)CN3C(=O)CC(CCCCc4ccc(c2c4)O1)N=C3N |
| InChI | InChI=1S/C27H32N4O3.C2H6/c1-27(2)15-22-21-13-17(10-11-23(21)34-27)6-3-4-9-20-14-24(32)31(26(28)29-20)16-18-7-5-8-19(12-18)25(33)30-22;1-2/h5,7-8,10-13,20,22H,3-4,6,9,14-16H2,1-2H3,(H2,28,29)(H,30,33);1-2H3 |
| InChIKey | MLMREKUABQGTOL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |