C26H38N4O3 — CID 176564736
(6R)-8-amino-6-ethyl-18,18-dimethyl-19-oxa-7,9,15-triazatetracyclo[14.6.2.26,9.020,24]hexacosa-1(23),7,20(24),21-tetraene-14,25-dione (PubChem CID 176564736) has the molecular formula C26H38N4O3 and a molecular weight of 454.62 g/mol. Its IUPAC name is (6R)-8-amino-6-ethyl-18,18-dimethyl-19-oxa-7,9,15-triazatetracyclo[14.6.2.26,9.020,24]hexacosa-1(23),7,20(24),21-tetraene-14,25-dione.
| Compound Name | (6R)-8-amino-6-ethyl-18,18-dimethyl-19-oxa-7,9,15-triazatetracyclo[14.6.2.26,9.020,24]hexacosa-1(23),7,20(24),21-tetraene-14,25-dione |
|---|---|
| PubChem CID | 176564736 |
| Molecular Formula | C26H38N4O3 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | (6R)-8-amino-6-ethyl-18,18-dimethyl-19-oxa-7,9,15-triazatetracyclo[14.6.2.26,9.020,24]hexacosa-1(23),7,20(24),21-tetraene-14,25-dione |
| SMILES | CC[C@@]12CCCCc3ccc4c(c3)C(CC(C)(C)O4)NC(=O)CCCCN(C(=O)C1)C(N)=N2 |
| InChI | InChI=1S/C26H38N4O3/c1-4-26-13-7-5-9-18-11-12-21-19(15-18)20(16-25(2,3)33-21)28-22(31)10-6-8-14-30(23(32)17-26)24(27)29-26/h11-12,15,20H,4-10,13-14,16-17H2,1-3H3,(H2,27,29)(H,28,31)/t20?,26-/m1/s1 |
| InChIKey | NARLIKOYMFDAOU-NBXNUCLWSA-N |
| XLogP | 4.00 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |