C31H38N4O3 — CID 168919058
(1R,5R,14S,16S)-3-amino-5,14-diethyl-23-oxa-2,4,17-triazahexacyclo[17.6.2.22,5.210,13.012,16.022,26]hentriaconta-3,10,12,19(27),20,22(26),28-heptaene-18,31-dione (PubChem CID 168919058) has the molecular formula C31H38N4O3 and a molecular weight of 514.67 g/mol. Its IUPAC name is (1R,5R,14S,16S)-3-amino-5,14-diethyl-23-oxa-2,4,17-triazahexacyclo[17.6.2.22,5.210,13.012,16.022,26]hentriaconta-3,10,12,19(27),20,22(26),28-heptaene-18,31-dione.
| Compound Name | (1R,5R,14S,16S)-3-amino-5,14-diethyl-23-oxa-2,4,17-triazahexacyclo[17.6.2.22,5.210,13.012,16.022,26]hentriaconta-3,10,12,19(27),20,22(26),28-heptaene-18,31-dione |
|---|---|
| PubChem CID | 168919058 |
| Molecular Formula | C31H38N4O3 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | (1R,5R,14S,16S)-3-amino-5,14-diethyl-23-oxa-2,4,17-triazahexacyclo[17.6.2.22,5.210,13.012,16.022,26]hentriaconta-3,10,12,19(27),20,22(26),28-heptaene-18,31-dione |
| SMILES | CC[C@H]1C[C@@H]2NC(=O)c3ccc4c(c3)[C@@H](CCO4)N3C(=O)C[C@@](CC)(CCCCc4ccc1c2c4)N=C3N |
| InChI | InChI=1S/C31H38N4O3/c1-3-20-17-25-23-15-19(8-10-22(20)23)7-5-6-13-31(4-2)18-28(36)35(30(32)34-31)26-12-14-38-27-11-9-21(16-24(26)27)29(37)33-25/h8-11,15-16,20,25-26H,3-7,12-14,17-18H2,1-2H3,(H2,32,34)(H,33,37)/t20-,25-,26+,31+/m0/s1 |
| InChIKey | QSAIZYMYUYYUST-NYFOKANOSA-N |
| XLogP | 5.30 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |