C30H40N4O2 — CID 172556875
(1R,5R,15R,16R)-3-amino-5-ethyl-9-methyl-23-oxa-2,4,17-triazahexacyclo[17.6.2.22,5.210,13.012,16.022,26]hentriaconta-3,10,12,19(27),20,22(26),28-heptaen-15-ol (PubChem CID 172556875) has the molecular formula C30H40N4O2 and a molecular weight of 488.68 g/mol. Its IUPAC name is (1R,5R,15R,16R)-3-amino-5-ethyl-9-methyl-23-oxa-2,4,17-triazahexacyclo[17.6.2.22,5.210,13.012,16.022,26]hentriaconta-3,10,12,19(27),20,22(26),28-heptaen-15-ol.
| Compound Name | (1R,5R,15R,16R)-3-amino-5-ethyl-9-methyl-23-oxa-2,4,17-triazahexacyclo[17.6.2.22,5.210,13.012,16.022,26]hentriaconta-3,10,12,19(27),20,22(26),28-heptaen-15-ol |
|---|---|
| PubChem CID | 172556875 |
| Molecular Formula | C30H40N4O2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | (1R,5R,15R,16R)-3-amino-5-ethyl-9-methyl-23-oxa-2,4,17-triazahexacyclo[17.6.2.22,5.210,13.012,16.022,26]hentriaconta-3,10,12,19(27),20,22(26),28-heptaen-15-ol |
| SMILES | CC[C@@]12CCCC(C)c3ccc4c(c3)[C@@H](NCc3ccc5c(c3)[C@@H](CCO5)N(CC1)C(N)=N2)[C@H](O)C4 |
| InChI | InChI=1S/C30H40N4O2/c1-3-30-11-4-5-19(2)21-7-8-22-17-26(35)28(23(22)16-21)32-18-20-6-9-27-24(15-20)25(10-14-36-27)34(13-12-30)29(31)33-30/h6-9,15-16,19,25-26,28,32,35H,3-5,10-14,17-18H2,1-2H3,(H2,31,33)/t19?,25-,26-,28-,30-/m1/s1 |
| InChIKey | HNTCLRYPQGJHGJ-LINULNDLSA-N |
| XLogP | 4.71 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |