C26H40N4O3 — CID 176564710
8-amino-18,18-dimethyl-19-oxa-7,9,15-triazatetracyclo[14.6.2.26,9.020,24]hexacosa-1(23),7,20(24),21-tetraene-14,25-dione;ethane (PubChem CID 176564710) has the molecular formula C26H40N4O3 and a molecular weight of 456.63 g/mol. Its IUPAC name is 8-amino-18,18-dimethyl-19-oxa-7,9,15-triazatetracyclo[14.6.2.26,9.020,24]hexacosa-1(23),7,20(24),21-tetraene-14,25-dione;ethane.
| Compound Name | 8-amino-18,18-dimethyl-19-oxa-7,9,15-triazatetracyclo[14.6.2.26,9.020,24]hexacosa-1(23),7,20(24),21-tetraene-14,25-dione;ethane |
|---|---|
| PubChem CID | 176564710 |
| Molecular Formula | C26H40N4O3 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | 8-amino-18,18-dimethyl-19-oxa-7,9,15-triazatetracyclo[14.6.2.26,9.020,24]hexacosa-1(23),7,20(24),21-tetraene-14,25-dione;ethane |
| SMILES | CC.CC1(C)CC2NC(=O)CCCCN3C(=O)CC(CCCCc4ccc(c2c4)O1)N=C3N |
| InChI | InChI=1S/C24H34N4O3.C2H6/c1-24(2)15-19-18-13-16(10-11-20(18)31-24)7-3-4-8-17-14-22(30)28(23(25)26-17)12-6-5-9-21(29)27-19;1-2/h10-11,13,17,19H,3-9,12,14-15H2,1-2H3,(H2,25,26)(H,27,29);1-2H3 |
| InChIKey | BCJROKBXDYBTPF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |