C24H28INO3 — CID 168922259
tert-butyl 1-[5-[(3-iodophenyl)methoxy]-2,3-dihydro-1H-inden-1-yl]azetidine-3-carboxylate (PubChem CID 168922259) has the molecular formula C24H28INO3 and a molecular weight of 505.40 g/mol. Its IUPAC name is tert-butyl 1-[5-[(3-iodophenyl)methoxy]-2,3-dihydro-1H-inden-1-yl]azetidine-3-carboxylate.
| Compound Name | tert-butyl 1-[5-[(3-iodophenyl)methoxy]-2,3-dihydro-1H-inden-1-yl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 168922259 |
| Molecular Formula | C24H28INO3 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | tert-butyl 1-[5-[(3-iodophenyl)methoxy]-2,3-dihydro-1H-inden-1-yl]azetidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CN(C2CCc3cc(OCc4cccc(I)c4)ccc32)C1 |
| InChI | InChI=1S/C24H28INO3/c1-24(2,3)29-23(27)18-13-26(14-18)22-10-7-17-12-20(8-9-21(17)22)28-15-16-5-4-6-19(25)11-16/h4-6,8-9,11-12,18,22H,7,10,13-15H2,1-3H3 |
| InChIKey | AZRQWJXORMICQD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|