C52H103N5O4 — CID 168924617
4-N-[3-[8-ethylhexadecyl(8-octylhexadecyl)amino]propyl]-5-N-methylpyrimidine-4,5-diamine;formic acid (PubChem CID 168924617) has the molecular formula C52H103N5O4 and a molecular weight of 862.43 g/mol. Its IUPAC name is 4-N-[3-[8-ethylhexadecyl(8-octylhexadecyl)amino]propyl]-5-N-methylpyrimidine-4,5-diamine;formic acid.
| Compound Name | 4-N-[3-[8-ethylhexadecyl(8-octylhexadecyl)amino]propyl]-5-N-methylpyrimidine-4,5-diamine;formic acid |
|---|---|
| PubChem CID | 168924617 |
| Molecular Formula | C52H103N5O4 |
| Molecular Weight | 862.43 g/mol |
| Exact Mass | 861.80 |
| IUPAC Name | 4-N-[3-[8-ethylhexadecyl(8-octylhexadecyl)amino]propyl]-5-N-methylpyrimidine-4,5-diamine;formic acid |
| SMILES | CCCCCCCCC(CC)CCCCCCCN(CCCCCCCC(CCCCCCCC)CCCCCCCC)CCCNc1ncncc1NC.O=CO.O=CO |
| InChI | InChI=1S/C50H99N5.2CH2O2/c1-6-10-13-16-21-28-36-47(9-4)37-29-24-19-26-33-42-55(44-35-41-53-50-49(51-5)45-52-46-54-50)43-34-27-20-25-32-40-48(38-30-22-17-14-11-7-2)39-31-23-18-15-12-8-3;2*2-1-3/h45-48,51H,6-44H2,1-5H3,(H,52,53,54);2*1H,(H,2,3) |
| InChIKey | BUMIZTZXRAZDAP-UHFFFAOYSA-N |
| XLogP | 15.60 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.43 |
| LogP ≤ 5 | 15.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|