C23H26N4O2S — CID 168926669
tert-butyl 4-[2-[5-(1-methylindazol-6-yl)-1,3-thiazol-2-yl]ethynyl]piperidine-1-carboxylate (PubChem CID 168926669) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is tert-butyl 4-[2-[5-(1-methylindazol-6-yl)-1,3-thiazol-2-yl]ethynyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[5-(1-methylindazol-6-yl)-1,3-thiazol-2-yl]ethynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168926669 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | tert-butyl 4-[2-[5-(1-methylindazol-6-yl)-1,3-thiazol-2-yl]ethynyl]piperidine-1-carboxylate |
| SMILES | Cn1ncc2ccc(-c3cnc(C#CC4CCN(C(=O)OC(C)(C)C)CC4)s3)cc21 |
| InChI | InChI=1S/C23H26N4O2S/c1-23(2,3)29-22(28)27-11-9-16(10-12-27)5-8-21-24-15-20(30-21)17-6-7-18-14-25-26(4)19(18)13-17/h6-7,13-16H,9-12H2,1-4H3 |
| InChIKey | ZJSKOHRIWSXAFG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|