C22H16ClF5N2O — CID 168929318
N-[5-(3-chloro-6-fluoro-4-methylidenecyclohepta-1,6-dien-1-yl)-2-fluoro-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 168929318) has the molecular formula C22H16ClF5N2O and a molecular weight of 454.83 g/mol. Its IUPAC name is N-[5-(3-chloro-6-fluoro-4-methylidenecyclohepta-1,6-dien-1-yl)-2-fluoro-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | N-[5-(3-chloro-6-fluoro-4-methylidenecyclohepta-1,6-dien-1-yl)-2-fluoro-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 168929318 |
| Molecular Formula | C22H16ClF5N2O |
| Molecular Weight | 454.83 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-[5-(3-chloro-6-fluoro-4-methylidenecyclohepta-1,6-dien-1-yl)-2-fluoro-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | C=C1CC(F)=CC(c2cc(NC(=O)c3ccnc(C(F)(F)F)c3)c(F)cc2C)=CC1Cl |
| InChI | InChI=1S/C22H16ClF5N2O/c1-11-6-18(25)19(10-16(11)14-7-15(24)5-12(2)17(23)8-14)30-21(31)13-3-4-29-20(9-13)22(26,27)28/h3-4,6-10,17H,2,5H2,1H3,(H,30,31) |
| InChIKey | SLSKXFPRCVPMTQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.83 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|