C10H13NO2 — CID 168930529
(E)-4-cyclopropyl-2-ethenyl-4-methyliminobut-2-enoic acid (PubChem CID 168930529) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (E)-4-cyclopropyl-2-ethenyl-4-methyliminobut-2-enoic acid.
| Compound Name | (E)-4-cyclopropyl-2-ethenyl-4-methyliminobut-2-enoic acid |
|---|---|
| PubChem CID | 168930529 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (E)-4-cyclopropyl-2-ethenyl-4-methyliminobut-2-enoic acid |
| SMILES | C=C/C(=C\C(=N\C)C1CC1)C(=O)O |
| InChI | InChI=1S/C10H13NO2/c1-3-7(10(12)13)6-9(11-2)8-4-5-8/h3,6,8H,1,4-5H2,2H3,(H,12,13)/b7-6+,11-9- |
| InChIKey | QJNFEIGHOJMSMT-FKTQTOOFSA-N |
| XLogP | 1.66 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|