About N-[(Z)-1-aminobut-2-enylidene]butanamide;formaldehyde;2-methylpropanal
N-[(Z)-1-aminobut-2-enylidene]butanamide;formaldehyde;2-methylpropanal (PubChem CID 168936579) has the molecular formula C13H24N2O3
and a molecular weight of 256.35 g/mol. Its IUPAC name is N-[(Z)-1-aminobut-2-enylidene]butanamide;formaldehyde;2-methylpropanal.
Molecular Properties
| Compound Name | N-[(Z)-1-aminobut-2-enylidene]butanamide;formaldehyde;2-methylpropanal |
| PubChem CID | 168936579 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | N-[(Z)-1-aminobut-2-enylidene]butanamide;formaldehyde;2-methylpropanal |
| SMILES | C/C=C\C(N)=N\C(=O)CCC.C=O.CC(C)C=O |
| InChI | InChI=1S/C8H14N2O.C4H8O.CH2O/c1-3-5-7(9)10-8(11)6-4-2;1-4(2)3-5;1-2/h3,5H,4,6H2,1-2H3,(H2,9,10,11);3-4H,1-2H3;1H2/b5-3-;; |
| InChIKey | QKERLKGHWJFUDJ-ORIPCLHRSA-N |
| XLogP | 1.90 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1-aminobut-2-enylidene]butanamide;formaldehyde;2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1-aminobut-2-enylidene]butanamide;formaldehyde;2-methylpropanal?
The IUPAC name of N-[(Z)-1-aminobut-2-enylidene]butanamide;formaldehyde;2-methylpropanal (CID 168936579) is N-[(Z)-1-aminobut-2-enylidene]butanamide;formaldehyde;2-methylpropanal.
What is the SMILES notation for N-[(Z)-1-aminobut-2-enylidene]butanamide;formaldehyde;2-methylpropanal?
The canonical SMILES for N-[(Z)-1-aminobut-2-enylidene]butanamide;formaldehyde;2-methylpropanal is C/C=C\C(N)=N\C(=O)CCC.C=O.CC(C)C=O.
What is the InChIKey of N-[(Z)-1-aminobut-2-enylidene]butanamide;formaldehyde;2-methylpropanal?
The InChIKey is QKERLKGHWJFUDJ-ORIPCLHRSA-N. The full InChI is InChI=1S/C8H14N2O.C4H8O.CH2O/c1-3-5-7(9)10-8(11)6-4-2;1-4(2)3-5;1-2/h3,5H,4,6H2,1-2H3,(H2,9,10,11);3-4H,1-2H3;1H2/b5-3-;;.
What are the key properties of N-[(Z)-1-aminobut-2-enylidene]butanamide;formaldehyde;2-methylpropanal?
N-[(Z)-1-aminobut-2-enylidene]butanamide;formaldehyde;2-methylpropanal has a molecular weight of 256.35 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1-aminobut-2-enylidene]butanamide;formaldehyde;2-methylpropanal is sourced from PubChem (CID 168936579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).