C27H40N4 — CID 168937042
(2E,4E)-4-(1,4-diazepan-1-yl)-7-methyl-N-[[(4E)-3-[(Z)-prop-1-enyl]imino-4-propylidenecyclohexa-1,5-dien-1-yl]methyl]octa-2,4,6-trien-3-amine (PubChem CID 168937042) has the molecular formula C27H40N4 and a molecular weight of 420.65 g/mol. Its IUPAC name is (2E,4E)-4-(1,4-diazepan-1-yl)-7-methyl-N-[[(4E)-3-[(Z)-prop-1-enyl]imino-4-propylidenecyclohexa-1,5-dien-1-yl]methyl]octa-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-4-(1,4-diazepan-1-yl)-7-methyl-N-[[(4E)-3-[(Z)-prop-1-enyl]imino-4-propylidenecyclohexa-1,5-dien-1-yl]methyl]octa-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 168937042 |
| Molecular Formula | C27H40N4 |
| Molecular Weight | 420.65 g/mol |
| Exact Mass | 420.33 |
| IUPAC Name | (2E,4E)-4-(1,4-diazepan-1-yl)-7-methyl-N-[[(4E)-3-[(Z)-prop-1-enyl]imino-4-propylidenecyclohexa-1,5-dien-1-yl]methyl]octa-2,4,6-trien-3-amine |
| SMILES | C/C=C\N=C1/C=C(CNC(=C/C)/C(=C\C=C(C)C)N2CCCNCC2)C=C/C1=C\CC |
| InChI | InChI=1S/C27H40N4/c1-6-10-24-13-12-23(20-26(24)29-15-7-2)21-30-25(8-3)27(14-11-22(4)5)31-18-9-16-28-17-19-31/h7-8,10-15,20,28,30H,6,9,16-19,21H2,1-5H3/b15-7-,24-10+,25-8+,27-14+,29-26+ |
| InChIKey | ZORPTRXYIJDUQE-OXVFUBPUSA-N |
| XLogP | 5.43 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.65 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|