C10H16BrNO2 — CID 168939076
1-(6-bromo-2-methyl-3-pyridinyl)ethane-1,2-diol;ethane (PubChem CID 168939076) has the molecular formula C10H16BrNO2 and a molecular weight of 262.15 g/mol. Its IUPAC name is 1-(6-bromo-2-methyl-3-pyridinyl)ethane-1,2-diol;ethane.
| Compound Name | 1-(6-bromo-2-methyl-3-pyridinyl)ethane-1,2-diol;ethane |
|---|---|
| PubChem CID | 168939076 |
| Molecular Formula | C10H16BrNO2 |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 1-(6-bromo-2-methyl-3-pyridinyl)ethane-1,2-diol;ethane |
| SMILES | CC.Cc1nc(Br)ccc1C(O)CO |
| InChI | InChI=1S/C8H10BrNO2.C2H6/c1-5-6(7(12)4-11)2-3-8(9)10-5;1-2/h2-3,7,11-12H,4H2,1H3;1-2H3 |
| InChIKey | WPKHYRIKZDZZAG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|