C24H28B2N4O3S — CID 168940025
CID 168940025 (PubChem CID 168940025) has the molecular formula C24H28B2N4O3S and a molecular weight of 474.20 g/mol.
| Compound Name | CID 168940025 |
|---|---|
| PubChem CID | 168940025 |
| Molecular Formula | C24H28B2N4O3S |
| Molecular Weight | 474.20 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | — |
| SMILES | [B]C([B])(C#C)NC(=O)CNC(=O)CN(C1CCN(Cc2cccc3ccccc23)CC1)S(C)=O |
| InChI | InChI=1S/C24H28B2N4O3S/c1-3-24(25,26)28-22(31)15-27-23(32)17-30(34(2)33)20-11-13-29(14-12-20)16-19-9-6-8-18-7-4-5-10-21(18)19/h1,4-10,20H,11-17H2,2H3,(H,27,32)(H,28,31) |
| InChIKey | MWNAVJHCKHOJHX-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.20 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|