C20H20N2 — CID 168941668
3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-5-phenyl-1H-indole (PubChem CID 168941668) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-5-phenyl-1H-indole.
| Compound Name | 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-5-phenyl-1H-indole |
|---|---|
| PubChem CID | 168941668 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-5-phenyl-1H-indole |
| SMILES | CN1CCC=C(c2c[nH]c3ccc(-c4ccccc4)cc23)C1 |
| InChI | InChI=1S/C20H20N2/c1-22-11-5-8-17(14-22)19-13-21-20-10-9-16(12-18(19)20)15-6-3-2-4-7-15/h2-4,6-10,12-13,21H,5,11,14H2,1H3 |
| InChIKey | FVDOTNUVKNDFOU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |