About N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine
N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine (PubChem CID 168943585) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine.
Molecular Properties
| Compound Name | N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine |
| PubChem CID | 168943585 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine |
| SMILES | CCNC(CC)Cc1ncc2ccccn12 |
| InChI | InChI=1S/C13H19N3/c1-3-11(14-4-2)9-13-15-10-12-7-5-6-8-16(12)13/h5-8,10-11,14H,3-4,9H2,1-2H3 |
| InChIKey | ULCLQVAVYRTFLB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine?
The IUPAC name of N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine (CID 168943585) is N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine.
What is the SMILES notation for N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine?
The canonical SMILES for N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine is CCNC(CC)Cc1ncc2ccccn12.
What is the InChIKey of N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine?
The InChIKey is ULCLQVAVYRTFLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3/c1-3-11(14-4-2)9-13-15-10-12-7-5-6-8-16(12)13/h5-8,10-11,14H,3-4,9H2,1-2H3.
What are the key properties of N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine?
N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine has a molecular weight of 217.32 g/mol, XLogP of 2.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine is sourced from PubChem (CID 168943585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).