C13H19N3 — CID 168943585
N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine (PubChem CID 168943585) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine.
| Compound Name | N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine |
|---|---|
| PubChem CID | 168943585 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N-ethyl-1-imidazo[1,5-a]pyridin-3-ylbutan-2-amine |
| SMILES | CCNC(CC)Cc1ncc2ccccn12 |
| InChI | InChI=1S/C13H19N3/c1-3-11(14-4-2)9-13-15-10-12-7-5-6-8-16(12)13/h5-8,10-11,14H,3-4,9H2,1-2H3 |
| InChIKey | ULCLQVAVYRTFLB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |