C23H26F3N7O4 — CID 168945507
1-tert-butyl-3-[3-(2-methylpropoxy)-4-nitrophenyl]-5-[[5-(trifluoromethyl)pyrazin-2-yl]amino]pyrazole-4-carboxamide (PubChem CID 168945507) has the molecular formula C23H26F3N7O4 and a molecular weight of 521.50 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(2-methylpropoxy)-4-nitrophenyl]-5-[[5-(trifluoromethyl)pyrazin-2-yl]amino]pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-3-[3-(2-methylpropoxy)-4-nitrophenyl]-5-[[5-(trifluoromethyl)pyrazin-2-yl]amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 168945507 |
| Molecular Formula | C23H26F3N7O4 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 1-tert-butyl-3-[3-(2-methylpropoxy)-4-nitrophenyl]-5-[[5-(trifluoromethyl)pyrazin-2-yl]amino]pyrazole-4-carboxamide |
| SMILES | CC(C)COc1cc(-c2nn(C(C)(C)C)c(Nc3cnc(C(F)(F)F)cn3)c2C(N)=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H26F3N7O4/c1-12(2)11-37-15-8-13(6-7-14(15)33(35)36)19-18(20(27)34)21(32(31-19)22(3,4)5)30-17-10-28-16(9-29-17)23(24,25)26/h6-10,12H,11H2,1-5H3,(H2,27,34)(H,29,30) |
| InChIKey | TYDKMIDNIRHSEJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 151.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|