C11H8ClF2NO2 — CID 168946898
1-(4,7-difluoro-1H-indol-3-yl)ethanone;formyl chloride (PubChem CID 168946898) has the molecular formula C11H8ClF2NO2 and a molecular weight of 259.64 g/mol. Its IUPAC name is 1-(4,7-difluoro-1H-indol-3-yl)ethanone;formyl chloride.
| Compound Name | 1-(4,7-difluoro-1H-indol-3-yl)ethanone;formyl chloride |
|---|---|
| PubChem CID | 168946898 |
| Molecular Formula | C11H8ClF2NO2 |
| Molecular Weight | 259.64 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 1-(4,7-difluoro-1H-indol-3-yl)ethanone;formyl chloride |
| SMILES | CC(=O)c1c[nH]c2c(F)ccc(F)c12.O=CCl |
| InChI | InChI=1S/C10H7F2NO.CHClO/c1-5(14)6-4-13-10-8(12)3-2-7(11)9(6)10;2-1-3/h2-4,13H,1H3;1H |
| InChIKey | BKTRDVTTYGPTCH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|