C17H15F2NO2 — CID 16894709
(3,4-difluorophenyl)-(2-phenylmorpholin-4-yl)methanone (PubChem CID 16894709) has the molecular formula C17H15F2NO2 and a molecular weight of 303.31 g/mol. Its IUPAC name is (3,4-difluorophenyl)-(2-phenylmorpholin-4-yl)methanone.
| Compound Name | (3,4-difluorophenyl)-(2-phenylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 16894709 |
| Molecular Formula | C17H15F2NO2 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (3,4-difluorophenyl)-(2-phenylmorpholin-4-yl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1)N1CCOC(c2ccccc2)C1 |
| InChI | InChI=1S/C17H15F2NO2/c18-14-7-6-13(10-15(14)19)17(21)20-8-9-22-16(11-20)12-4-2-1-3-5-12/h1-7,10,16H,8-9,11H2 |
| InChIKey | WVHZBEWAPHFTQI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |