C10H21BO2Si — CID 168948884
[(E)-3-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-trimethylsilane (PubChem CID 168948884) has the molecular formula C10H21BO2Si and a molecular weight of 212.17 g/mol. Its IUPAC name is [(E)-3-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-trimethylsilane.
| Compound Name | [(E)-3-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 168948884 |
| Molecular Formula | C10H21BO2Si |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | [(E)-3-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-trimethylsilane |
| SMILES | CC1OB(C/C=C/[Si](C)(C)C)OC1C |
| InChI | InChI=1S/C10H21BO2Si/c1-9-10(2)13-11(12-9)7-6-8-14(3,4)5/h6,8-10H,7H2,1-5H3/b8-6+ |
| InChIKey | ZXBLDGMGJZSOQC-SOFGYWHQSA-N |
| XLogP | 2.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|