C24H30N4O6 — CID 168953639
tert-butyl N-[4-[3-methoxy-4-[(5-methoxy-1,3-benzoxazol-2-yl)amino]anilino]-4-oxobutyl]carbamate (PubChem CID 168953639) has the molecular formula C24H30N4O6 and a molecular weight of 470.53 g/mol. Its IUPAC name is tert-butyl N-[4-[3-methoxy-4-[(5-methoxy-1,3-benzoxazol-2-yl)amino]anilino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-methoxy-4-[(5-methoxy-1,3-benzoxazol-2-yl)amino]anilino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 168953639 |
| Molecular Formula | C24H30N4O6 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | tert-butyl N-[4-[3-methoxy-4-[(5-methoxy-1,3-benzoxazol-2-yl)amino]anilino]-4-oxobutyl]carbamate |
| SMILES | COc1ccc2oc(Nc3ccc(NC(=O)CCCNC(=O)OC(C)(C)C)cc3OC)nc2c1 |
| InChI | InChI=1S/C24H30N4O6/c1-24(2,3)34-23(30)25-12-6-7-21(29)26-15-8-10-17(20(13-15)32-5)27-22-28-18-14-16(31-4)9-11-19(18)33-22/h8-11,13-14H,6-7,12H2,1-5H3,(H,25,30)(H,26,29)(H,27,28) |
| InChIKey | XQDLIYLAKGZLMG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 123.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|