C11H5F2N2O3PS — CID 168955204
[(3,6-dicyano-1-benzothiophen-2-yl)-difluoromethyl]phosphonic acid (PubChem CID 168955204) has the molecular formula C11H5F2N2O3PS and a molecular weight of 314.21 g/mol. Its IUPAC name is [(3,6-dicyano-1-benzothiophen-2-yl)-difluoromethyl]phosphonic acid.
| Compound Name | [(3,6-dicyano-1-benzothiophen-2-yl)-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 168955204 |
| Molecular Formula | C11H5F2N2O3PS |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | [(3,6-dicyano-1-benzothiophen-2-yl)-difluoromethyl]phosphonic acid |
| SMILES | N#Cc1ccc2c(C#N)c(C(F)(F)P(=O)(O)O)sc2c1 |
| InChI | InChI=1S/C11H5F2N2O3PS/c12-11(13,19(16,17)18)10-8(5-15)7-2-1-6(4-14)3-9(7)20-10/h1-3H,(H2,16,17,18) |
| InChIKey | FLMVPRYCYKPJMF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|