C13H11BrF5O3PS — CID 168955428
[[3-bromo-7-(4,4,4-trifluorobutoxy)-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid (PubChem CID 168955428) has the molecular formula C13H11BrF5O3PS and a molecular weight of 453.16 g/mol. Its IUPAC name is [[3-bromo-7-(4,4,4-trifluorobutoxy)-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid.
| Compound Name | [[3-bromo-7-(4,4,4-trifluorobutoxy)-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid |
|---|---|
| PubChem CID | 168955428 |
| Molecular Formula | C13H11BrF5O3PS |
| Molecular Weight | 453.16 g/mol |
| Exact Mass | 451.93 |
| IUPAC Name | [[3-bromo-7-(4,4,4-trifluorobutoxy)-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid |
| SMILES | OP(O)C(F)(F)c1sc2c(OCCCC(F)(F)F)cccc2c1Br |
| InChI | InChI=1S/C13H11BrF5O3PS/c14-9-7-3-1-4-8(22-6-2-5-12(15,16)17)10(7)24-11(9)13(18,19)23(20)21/h1,3-4,20-21H,2,5-6H2 |
| InChIKey | TVCBUJNPHVSIBH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.16 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|