C13H12BrF5NO3PS — CID 168954963
[[5-amino-3-bromo-7-(4,4,4-trifluorobutoxy)-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid (PubChem CID 168954963) has the molecular formula C13H12BrF5NO3PS and a molecular weight of 468.18 g/mol. Its IUPAC name is [[5-amino-3-bromo-7-(4,4,4-trifluorobutoxy)-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid.
| Compound Name | [[5-amino-3-bromo-7-(4,4,4-trifluorobutoxy)-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid |
|---|---|
| PubChem CID | 168954963 |
| Molecular Formula | C13H12BrF5NO3PS |
| Molecular Weight | 468.18 g/mol |
| Exact Mass | 466.94 |
| IUPAC Name | [[5-amino-3-bromo-7-(4,4,4-trifluorobutoxy)-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid |
| SMILES | Nc1cc(OCCCC(F)(F)F)c2sc(C(F)(F)P(O)O)c(Br)c2c1 |
| InChI | InChI=1S/C13H12BrF5NO3PS/c14-9-7-4-6(20)5-8(23-3-1-2-12(15,16)17)10(7)25-11(9)13(18,19)24(21)22/h4-5,21-22H,1-3,20H2 |
| InChIKey | QWWKCFDBXMMKFJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.18 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|