C26H32FN3S — CID 168956944
1-[6-(3-cyclopropyl-2-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]-N-cyclopropylsulfanylethanamine (PubChem CID 168956944) has the molecular formula C26H32FN3S and a molecular weight of 437.63 g/mol. Its IUPAC name is 1-[6-(3-cyclopropyl-2-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]-N-cyclopropylsulfanylethanamine.
| Compound Name | 1-[6-(3-cyclopropyl-2-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]-N-cyclopropylsulfanylethanamine |
|---|---|
| PubChem CID | 168956944 |
| Molecular Formula | C26H32FN3S |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 1-[6-(3-cyclopropyl-2-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]-N-cyclopropylsulfanylethanamine |
| SMILES | CC(NSC1CC1)c1cn(CC(C)(C)C)c2cc(-c3ncccc3C3CC3)c(F)cc12 |
| InChI | InChI=1S/C26H32FN3S/c1-16(29-31-18-9-10-18)22-14-30(15-26(2,3)4)24-13-21(23(27)12-20(22)24)25-19(17-7-8-17)6-5-11-28-25/h5-6,11-14,16-18,29H,7-10,15H2,1-4H3 |
| InChIKey | SJXRVOUFDKTHDS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|