C25H28F7N3OS — CID 174059922
tert-butyl-[[1-[1-(2,2-dimethylpropyl)-5-fluoro-6-[2-(trifluoromethyl)-3-pyridinyl]indol-3-yl]-2,2,2-trifluoroethyl]amino]-oxidosulfanium (PubChem CID 174059922) has the molecular formula C25H28F7N3OS and a molecular weight of 551.57 g/mol. Its IUPAC name is tert-butyl-[[1-[1-(2,2-dimethylpropyl)-5-fluoro-6-[2-(trifluoromethyl)-3-pyridinyl]indol-3-yl]-2,2,2-trifluoroethyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[1-[1-(2,2-dimethylpropyl)-5-fluoro-6-[2-(trifluoromethyl)-3-pyridinyl]indol-3-yl]-2,2,2-trifluoroethyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174059922 |
| Molecular Formula | C25H28F7N3OS |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | tert-butyl-[[1-[1-(2,2-dimethylpropyl)-5-fluoro-6-[2-(trifluoromethyl)-3-pyridinyl]indol-3-yl]-2,2,2-trifluoroethyl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)Cn1cc(C(N[S+]([O-])C(C)(C)C)C(F)(F)F)c2cc(F)c(-c3cccnc3C(F)(F)F)cc21 |
| InChI | InChI=1S/C25H28F7N3OS/c1-22(2,3)13-35-12-17(21(25(30,31)32)34-37(36)23(4,5)6)16-10-18(26)15(11-19(16)35)14-8-7-9-33-20(14)24(27,28)29/h7-12,21,34H,13H2,1-6H3 |
| InChIKey | RUHSFOKFFDCDFH-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 52.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|