C25H28F4N2 — CID 169304583
(1S)-1-[1-(2,2-dimethylpropyl)-5-fluoro-6-(5,6,7,8-tetrahydronaphthalen-1-yl)indol-3-yl]-2,2,2-trifluoroethanamine (PubChem CID 169304583) has the molecular formula C25H28F4N2 and a molecular weight of 432.51 g/mol. Its IUPAC name is (1S)-1-[1-(2,2-dimethylpropyl)-5-fluoro-6-(5,6,7,8-tetrahydronaphthalen-1-yl)indol-3-yl]-2,2,2-trifluoroethanamine.
| Compound Name | (1S)-1-[1-(2,2-dimethylpropyl)-5-fluoro-6-(5,6,7,8-tetrahydronaphthalen-1-yl)indol-3-yl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 169304583 |
| Molecular Formula | C25H28F4N2 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | (1S)-1-[1-(2,2-dimethylpropyl)-5-fluoro-6-(5,6,7,8-tetrahydronaphthalen-1-yl)indol-3-yl]-2,2,2-trifluoroethanamine |
| SMILES | CC(C)(C)Cn1cc([C@H](N)C(F)(F)F)c2cc(F)c(-c3cccc4c3CCCC4)cc21 |
| InChI | InChI=1S/C25H28F4N2/c1-24(2,3)14-31-13-20(23(30)25(27,28)29)19-11-21(26)18(12-22(19)31)17-10-6-8-15-7-4-5-9-16(15)17/h6,8,10-13,23H,4-5,7,9,14,30H2,1-3H3/t23-/m0/s1 |
| InChIKey | USVHSPWHOLGNHY-QHCPKHFHSA-N |
| XLogP | 6.93 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |