C23H27ClFN3S — CID 170041561
1-[6-(4-chloro-3-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]-N-cyclopropylsulfanylethanamine (PubChem CID 170041561) has the molecular formula C23H27ClFN3S and a molecular weight of 432.01 g/mol. Its IUPAC name is 1-[6-(4-chloro-3-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]-N-cyclopropylsulfanylethanamine.
| Compound Name | 1-[6-(4-chloro-3-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]-N-cyclopropylsulfanylethanamine |
|---|---|
| PubChem CID | 170041561 |
| Molecular Formula | C23H27ClFN3S |
| Molecular Weight | 432.01 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-[6-(4-chloro-3-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]-N-cyclopropylsulfanylethanamine |
| SMILES | CC(NSC1CC1)c1cn(CC(C)(C)C)c2cc(-c3cnccc3Cl)c(F)cc12 |
| InChI | InChI=1S/C23H27ClFN3S/c1-14(27-29-15-5-6-15)19-12-28(13-23(2,3)4)22-10-16(21(25)9-17(19)22)18-11-26-8-7-20(18)24/h7-12,14-15,27H,5-6,13H2,1-4H3 |
| InChIKey | VRIVMFNYYJBGPB-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.01 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|