C23H25FN4S — CID 170040906
2-[3-[(cyclopropylsulfanylamino)methyl]-1-(2,2-dimethylpropyl)-5-fluoroindol-6-yl]pyridine-3-carbonitrile (PubChem CID 170040906) has the molecular formula C23H25FN4S and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-[3-[(cyclopropylsulfanylamino)methyl]-1-(2,2-dimethylpropyl)-5-fluoroindol-6-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[3-[(cyclopropylsulfanylamino)methyl]-1-(2,2-dimethylpropyl)-5-fluoroindol-6-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 170040906 |
| Molecular Formula | C23H25FN4S |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-[3-[(cyclopropylsulfanylamino)methyl]-1-(2,2-dimethylpropyl)-5-fluoroindol-6-yl]pyridine-3-carbonitrile |
| SMILES | CC(C)(C)Cn1cc(CNSC2CC2)c2cc(F)c(-c3ncccc3C#N)cc21 |
| InChI | InChI=1S/C23H25FN4S/c1-23(2,3)14-28-13-16(12-27-29-17-6-7-17)18-9-20(24)19(10-21(18)28)22-15(11-25)5-4-8-26-22/h4-5,8-10,13,17,27H,6-7,12,14H2,1-3H3 |
| InChIKey | SEYMTNIHUQGUHP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|