C22H26F4N4O2S — CID 168956766
1-(2,2-dimethylpropyl)-3-[(dimethylsulfamoylamino)methyl]-5-fluoro-6-[2-(trifluoromethyl)-3-pyridinyl]indole (PubChem CID 168956766) has the molecular formula C22H26F4N4O2S and a molecular weight of 486.54 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-[(dimethylsulfamoylamino)methyl]-5-fluoro-6-[2-(trifluoromethyl)-3-pyridinyl]indole.
| Compound Name | 1-(2,2-dimethylpropyl)-3-[(dimethylsulfamoylamino)methyl]-5-fluoro-6-[2-(trifluoromethyl)-3-pyridinyl]indole |
|---|---|
| PubChem CID | 168956766 |
| Molecular Formula | C22H26F4N4O2S |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-[(dimethylsulfamoylamino)methyl]-5-fluoro-6-[2-(trifluoromethyl)-3-pyridinyl]indole |
| SMILES | CN(C)S(=O)(=O)NCc1cn(CC(C)(C)C)c2cc(-c3cccnc3C(F)(F)F)c(F)cc12 |
| InChI | InChI=1S/C22H26F4N4O2S/c1-21(2,3)13-30-12-14(11-28-33(31,32)29(4)5)16-9-18(23)17(10-19(16)30)15-7-6-8-27-20(15)22(24,25)26/h6-10,12,28H,11,13H2,1-5H3 |
| InChIKey | UFJKMVXNIXIGMM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|