C24H28F3N3S — CID 168956878
N-cyclobutylsulfanyl-1-[1-(2,2-dimethylpropyl)-6-[2-(trifluoromethyl)-3-pyridinyl]indol-3-yl]methanamine (PubChem CID 168956878) has the molecular formula C24H28F3N3S and a molecular weight of 447.57 g/mol. Its IUPAC name is N-cyclobutylsulfanyl-1-[1-(2,2-dimethylpropyl)-6-[2-(trifluoromethyl)-3-pyridinyl]indol-3-yl]methanamine.
| Compound Name | N-cyclobutylsulfanyl-1-[1-(2,2-dimethylpropyl)-6-[2-(trifluoromethyl)-3-pyridinyl]indol-3-yl]methanamine |
|---|---|
| PubChem CID | 168956878 |
| Molecular Formula | C24H28F3N3S |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N-cyclobutylsulfanyl-1-[1-(2,2-dimethylpropyl)-6-[2-(trifluoromethyl)-3-pyridinyl]indol-3-yl]methanamine |
| SMILES | CC(C)(C)Cn1cc(CNSC2CCC2)c2ccc(-c3cccnc3C(F)(F)F)cc21 |
| InChI | InChI=1S/C24H28F3N3S/c1-23(2,3)15-30-14-17(13-29-31-18-6-4-7-18)19-10-9-16(12-21(19)30)20-8-5-11-28-22(20)24(25,26)27/h5,8-12,14,18,29H,4,6-7,13,15H2,1-3H3 |
| InChIKey | ZCDOSMJZVYHKQU-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|