C29H37N3O3S — CID 168958890
tert-butyl N-[2-[2-[[9-ethyl-7-(4-methylthiophen-2-yl)carbazol-3-yl]methylamino]ethoxy]ethyl]carbamate (PubChem CID 168958890) has the molecular formula C29H37N3O3S and a molecular weight of 507.70 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[[9-ethyl-7-(4-methylthiophen-2-yl)carbazol-3-yl]methylamino]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[[9-ethyl-7-(4-methylthiophen-2-yl)carbazol-3-yl]methylamino]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 168958890 |
| Molecular Formula | C29H37N3O3S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | tert-butyl N-[2-[2-[[9-ethyl-7-(4-methylthiophen-2-yl)carbazol-3-yl]methylamino]ethoxy]ethyl]carbamate |
| SMILES | CCn1c2ccc(CNCCOCCNC(=O)OC(C)(C)C)cc2c2ccc(-c3cc(C)cs3)cc21 |
| InChI | InChI=1S/C29H37N3O3S/c1-6-32-25-10-7-21(18-30-11-13-34-14-12-31-28(33)35-29(3,4)5)16-24(25)23-9-8-22(17-26(23)32)27-15-20(2)19-36-27/h7-10,15-17,19,30H,6,11-14,18H2,1-5H3,(H,31,33) |
| InChIKey | QFODYRQFOBLPSR-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|