C16H18O — CID 168962351
3-(cyclohexen-1-yl)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 168962351) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-(cyclohexen-1-yl)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 3-(cyclohexen-1-yl)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 168962351 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 3-(cyclohexen-1-yl)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CC(C2=CCCCC2)Cc2ccccc21 |
| InChI | InChI=1S/C16H18O/c17-16-11-14(12-6-2-1-3-7-12)10-13-8-4-5-9-15(13)16/h4-6,8-9,14H,1-3,7,10-11H2 |
| InChIKey | ZHDPCHQAHBXWJZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|