C22H23ClN4O — CID 168963604
4-chloro-2-(4-cyclopentylphenyl)-5-(2-pyridin-2-ylethylamino)pyridazin-3-one (PubChem CID 168963604) has the molecular formula C22H23ClN4O and a molecular weight of 394.91 g/mol. Its IUPAC name is 4-chloro-2-(4-cyclopentylphenyl)-5-(2-pyridin-2-ylethylamino)pyridazin-3-one.
| Compound Name | 4-chloro-2-(4-cyclopentylphenyl)-5-(2-pyridin-2-ylethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 168963604 |
| Molecular Formula | C22H23ClN4O |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-chloro-2-(4-cyclopentylphenyl)-5-(2-pyridin-2-ylethylamino)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NCCc2ccccn2)cnn1-c1ccc(C2CCCC2)cc1 |
| InChI | InChI=1S/C22H23ClN4O/c23-21-20(25-14-12-18-7-3-4-13-24-18)15-26-27(22(21)28)19-10-8-17(9-11-19)16-5-1-2-6-16/h3-4,7-11,13,15-16,25H,1-2,5-6,12,14H2 |
| InChIKey | BNYYPOIWLABYJL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |