C23H30ClFN4O3 — CID 168964045
4-chloro-2-[4-[(R)-(6-fluoro-2-methyl-3-pyridinyl)-hydroxymethyl]cyclohexyl]-5-(oxan-3-ylmethylamino)pyridazin-3-one (PubChem CID 168964045) has the molecular formula C23H30ClFN4O3 and a molecular weight of 464.97 g/mol. Its IUPAC name is 4-chloro-2-[4-[(R)-(6-fluoro-2-methyl-3-pyridinyl)-hydroxymethyl]cyclohexyl]-5-(oxan-3-ylmethylamino)pyridazin-3-one.
| Compound Name | 4-chloro-2-[4-[(R)-(6-fluoro-2-methyl-3-pyridinyl)-hydroxymethyl]cyclohexyl]-5-(oxan-3-ylmethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 168964045 |
| Molecular Formula | C23H30ClFN4O3 |
| Molecular Weight | 464.97 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 4-chloro-2-[4-[(R)-(6-fluoro-2-methyl-3-pyridinyl)-hydroxymethyl]cyclohexyl]-5-(oxan-3-ylmethylamino)pyridazin-3-one |
| SMILES | Cc1nc(F)ccc1[C@H](O)C1CCC(n2ncc(NCC3CCCOC3)c(Cl)c2=O)CC1 |
| InChI | InChI=1S/C23H30ClFN4O3/c1-14-18(8-9-20(25)28-14)22(30)16-4-6-17(7-5-16)29-23(31)21(24)19(12-27-29)26-11-15-3-2-10-32-13-15/h8-9,12,15-17,22,26,30H,2-7,10-11,13H2,1H3/t15?,16?,17?,22-/m1/s1 |
| InChIKey | QYWNPLRWNMRBDW-JKXYTJSFSA-N |
| XLogP | 4.04 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.97 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|