C16H25ClN4O2 — CID 168964362
4-chloro-5-[[(1R)-1-[(3S)-oxan-3-yl]ethyl]amino]-2-piperidin-4-ylpyridazin-3-one (PubChem CID 168964362) has the molecular formula C16H25ClN4O2 and a molecular weight of 340.86 g/mol. Its IUPAC name is 4-chloro-5-[[(1R)-1-[(3S)-oxan-3-yl]ethyl]amino]-2-piperidin-4-ylpyridazin-3-one.
| Compound Name | 4-chloro-5-[[(1R)-1-[(3S)-oxan-3-yl]ethyl]amino]-2-piperidin-4-ylpyridazin-3-one |
|---|---|
| PubChem CID | 168964362 |
| Molecular Formula | C16H25ClN4O2 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-chloro-5-[[(1R)-1-[(3S)-oxan-3-yl]ethyl]amino]-2-piperidin-4-ylpyridazin-3-one |
| SMILES | C[C@@H](Nc1cnn(C2CCNCC2)c(=O)c1Cl)[C@@H]1CCCOC1 |
| InChI | InChI=1S/C16H25ClN4O2/c1-11(12-3-2-8-23-10-12)20-14-9-19-21(16(22)15(14)17)13-4-6-18-7-5-13/h9,11-13,18,20H,2-8,10H2,1H3/t11-,12-/m1/s1 |
| InChIKey | SOKSDUVJKGCLNX-VXGBXAGGSA-N |
| XLogP | 2.05 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |