C33H50N6O3S — CID 168966193
[4-[7-amino-4-butyl-3-(oxan-4-ylmethyl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-11-yl]piperidin-1-yl]-[4-(2-aminoethoxymethyl)cyclohexyl]methanone (PubChem CID 168966193) has the molecular formula C33H50N6O3S and a molecular weight of 610.87 g/mol. Its IUPAC name is [4-[7-amino-4-butyl-3-(oxan-4-ylmethyl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-11-yl]piperidin-1-yl]-[4-(2-aminoethoxymethyl)cyclohexyl]methanone.
| Compound Name | [4-[7-amino-4-butyl-3-(oxan-4-ylmethyl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-11-yl]piperidin-1-yl]-[4-(2-aminoethoxymethyl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 168966193 |
| Molecular Formula | C33H50N6O3S |
| Molecular Weight | 610.87 g/mol |
| Exact Mass | 610.37 |
| IUPAC Name | [4-[7-amino-4-butyl-3-(oxan-4-ylmethyl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-11-yl]piperidin-1-yl]-[4-(2-aminoethoxymethyl)cyclohexyl]methanone |
| SMILES | CCCCc1nc2c(N)nc3cc(C4CCN(C(=O)C5CCC(COCCN)CC5)CC4)sc3c2n1CC1CCOCC1 |
| InChI | InChI=1S/C33H50N6O3S/c1-2-3-4-28-37-29-30(39(28)20-22-11-16-41-17-12-22)31-26(36-32(29)35)19-27(43-31)24-9-14-38(15-10-24)33(40)25-7-5-23(6-8-25)21-42-18-13-34/h19,22-25H,2-18,20-21,34H2,1H3,(H2,35,36) |
| InChIKey | UUHYJKCLDWLIHY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.87 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|