C21H32N6OS — CID 176791410
11-[1-[2-(2-aminoethoxy)ethyl]piperidin-4-yl]-4-butyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine (PubChem CID 176791410) has the molecular formula C21H32N6OS and a molecular weight of 416.60 g/mol. Its IUPAC name is 11-[1-[2-(2-aminoethoxy)ethyl]piperidin-4-yl]-4-butyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine.
| Compound Name | 11-[1-[2-(2-aminoethoxy)ethyl]piperidin-4-yl]-4-butyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
|---|---|
| PubChem CID | 176791410 |
| Molecular Formula | C21H32N6OS |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 11-[1-[2-(2-aminoethoxy)ethyl]piperidin-4-yl]-4-butyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
| SMILES | CCCCc1nc2c(N)nc3cc(C4CCN(CCOCCN)CC4)sc3c2[nH]1 |
| InChI | InChI=1S/C21H32N6OS/c1-2-3-4-17-25-18-19(26-17)21(23)24-15-13-16(29-20(15)18)14-5-8-27(9-6-14)10-12-28-11-7-22/h13-14H,2-12,22H2,1H3,(H2,23,24)(H,25,26) |
| InChIKey | OJVJVAHDNNZPKP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|