C22H33N5S — CID 168966279
N-tert-butyl-4-butyl-11-(1-methylpiperidin-4-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine (PubChem CID 168966279) has the molecular formula C22H33N5S and a molecular weight of 399.61 g/mol. Its IUPAC name is N-tert-butyl-4-butyl-11-(1-methylpiperidin-4-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine.
| Compound Name | N-tert-butyl-4-butyl-11-(1-methylpiperidin-4-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
|---|---|
| PubChem CID | 168966279 |
| Molecular Formula | C22H33N5S |
| Molecular Weight | 399.61 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | N-tert-butyl-4-butyl-11-(1-methylpiperidin-4-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
| SMILES | CCCCc1nc2c(NC(C)(C)C)nc3cc(C4CCN(C)CC4)sc3c2[nH]1 |
| InChI | InChI=1S/C22H33N5S/c1-6-7-8-17-24-18-19(25-17)21(26-22(2,3)4)23-15-13-16(28-20(15)18)14-9-11-27(5)12-10-14/h13-14H,6-12H2,1-5H3,(H,23,26)(H,24,25) |
| InChIKey | ZISQPEXHYCYBOD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |