C18H16N4O2 — CID 168966701
7-hydrazinyl-2-[(4-methoxyphenyl)methyl]-2,5-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one (PubChem CID 168966701) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 7-hydrazinyl-2-[(4-methoxyphenyl)methyl]-2,5-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one.
| Compound Name | 7-hydrazinyl-2-[(4-methoxyphenyl)methyl]-2,5-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one |
|---|---|
| PubChem CID | 168966701 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 7-hydrazinyl-2-[(4-methoxyphenyl)methyl]-2,5-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one |
| SMILES | COc1ccc(CN2C(=O)c3ncc(NN)c4cccc2c34)cc1 |
| InChI | InChI=1S/C18H16N4O2/c1-24-12-7-5-11(6-8-12)10-22-15-4-2-3-13-14(21-19)9-20-17(16(13)15)18(22)23/h2-9,21H,10,19H2,1H3 |
| InChIKey | PKKWBISZWGFTEM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|