C6H2BrClN2S — CID 168966810
7-bromo-5-chloro-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 168966810) has the molecular formula C6H2BrClN2S and a molecular weight of 249.52 g/mol. Its IUPAC name is 7-bromo-5-chloro-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 7-bromo-5-chloro-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 168966810 |
| Molecular Formula | C6H2BrClN2S |
| Molecular Weight | 249.52 g/mol |
| Exact Mass | 247.88 |
| IUPAC Name | 7-bromo-5-chloro-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | Clc1cc(Br)c2ncsc2n1 |
| InChI | InChI=1S/C6H2BrClN2S/c7-3-1-4(8)10-6-5(3)9-2-11-6/h1-2H |
| InChIKey | MHHYGKGFIWSMFV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|