C22H29N9O — CID 168967314
1-[(2,4-diaminopteridin-6-yl)methyl]-N-[4-(methylamino)butyl]-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 168967314) has the molecular formula C22H29N9O and a molecular weight of 435.54 g/mol. Its IUPAC name is 1-[(2,4-diaminopteridin-6-yl)methyl]-N-[4-(methylamino)butyl]-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | 1-[(2,4-diaminopteridin-6-yl)methyl]-N-[4-(methylamino)butyl]-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 168967314 |
| Molecular Formula | C22H29N9O |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 1-[(2,4-diaminopteridin-6-yl)methyl]-N-[4-(methylamino)butyl]-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | CNCCCCNC(=O)c1ccc2c(c1)CCCN2Cc1cnc2nc(N)nc(N)c2n1 |
| InChI | InChI=1S/C22H29N9O/c1-25-8-2-3-9-26-21(32)15-6-7-17-14(11-15)5-4-10-31(17)13-16-12-27-20-18(28-16)19(23)29-22(24)30-20/h6-7,11-12,25H,2-5,8-10,13H2,1H3,(H,26,32)(H4,23,24,27,29,30) |
| InChIKey | MBTJZAFOAWQFGC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|