C21H29N8O3P — CID 58623709
4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]-N-[3-[ethoxy(methyl)phosphoryl]propyl]benzamide (PubChem CID 58623709) has the molecular formula C21H29N8O3P and a molecular weight of 472.49 g/mol. Its IUPAC name is 4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]-N-[3-[ethoxy(methyl)phosphoryl]propyl]benzamide.
| Compound Name | 4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]-N-[3-[ethoxy(methyl)phosphoryl]propyl]benzamide |
|---|---|
| PubChem CID | 58623709 |
| Molecular Formula | C21H29N8O3P |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]-N-[3-[ethoxy(methyl)phosphoryl]propyl]benzamide |
| SMILES | CCOP(C)(=O)CCCNC(=O)c1ccc(N(C)Cc2cnc3nc(N)nc(N)c3n2)cc1 |
| InChI | InChI=1S/C21H29N8O3P/c1-4-32-33(3,31)11-5-10-24-20(30)14-6-8-16(9-7-14)29(2)13-15-12-25-19-17(26-15)18(22)27-21(23)28-19/h6-9,12H,4-5,10-11,13H2,1-3H3,(H,24,30)(H4,22,23,25,27,28) |
| InChIKey | YXKTUOOGDGFODH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 162.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|