C20H23N7O3 — CID 143991776
4-[[4-[(4-amino-2-methylpteridin-6-yl)methyl-methylamino]benzoyl]amino]butanoic acid (PubChem CID 143991776) has the molecular formula C20H23N7O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is 4-[[4-[(4-amino-2-methylpteridin-6-yl)methyl-methylamino]benzoyl]amino]butanoic acid.
| Compound Name | 4-[[4-[(4-amino-2-methylpteridin-6-yl)methyl-methylamino]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 143991776 |
| Molecular Formula | C20H23N7O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 4-[[4-[(4-amino-2-methylpteridin-6-yl)methyl-methylamino]benzoyl]amino]butanoic acid |
| SMILES | Cc1nc(N)c2nc(CN(C)c3ccc(C(=O)NCCCC(=O)O)cc3)cnc2n1 |
| InChI | InChI=1S/C20H23N7O3/c1-12-24-18(21)17-19(25-12)23-10-14(26-17)11-27(2)15-7-5-13(6-8-15)20(30)22-9-3-4-16(28)29/h5-8,10H,3-4,9,11H2,1-2H3,(H,22,30)(H,28,29)(H2,21,23,24,25) |
| InChIKey | AUFJNSXZGBPNJP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 147.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|