C15H19F3IN3O3 — CID 168975164
ethyl 1-[5-iodo-6-(2,2,2-trifluoroethoxymethyl)pyrazin-2-yl]piperidine-4-carboxylate (PubChem CID 168975164) has the molecular formula C15H19F3IN3O3 and a molecular weight of 473.23 g/mol. Its IUPAC name is ethyl 1-[5-iodo-6-(2,2,2-trifluoroethoxymethyl)pyrazin-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-iodo-6-(2,2,2-trifluoroethoxymethyl)pyrazin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 168975164 |
| Molecular Formula | C15H19F3IN3O3 |
| Molecular Weight | 473.23 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | ethyl 1-[5-iodo-6-(2,2,2-trifluoroethoxymethyl)pyrazin-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2cnc(I)c(COCC(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C15H19F3IN3O3/c1-2-25-14(23)10-3-5-22(6-4-10)12-7-20-13(19)11(21-12)8-24-9-15(16,17)18/h7,10H,2-6,8-9H2,1H3 |
| InChIKey | YPVWJDZVYQOVOL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|