C32H40N3O5PS — CID 168982126
propyl 2-[[[2-[[(6S)-9-methyl-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]carbamoyl]-1-benzothiophen-5-yl]methyl-phenoxyphosphanyl]amino]acetate (PubChem CID 168982126) has the molecular formula C32H40N3O5PS and a molecular weight of 609.73 g/mol. Its IUPAC name is propyl 2-[[[2-[[(6S)-9-methyl-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]carbamoyl]-1-benzothiophen-5-yl]methyl-phenoxyphosphanyl]amino]acetate.
| Compound Name | propyl 2-[[[2-[[(6S)-9-methyl-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]carbamoyl]-1-benzothiophen-5-yl]methyl-phenoxyphosphanyl]amino]acetate |
|---|---|
| PubChem CID | 168982126 |
| Molecular Formula | C32H40N3O5PS |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | propyl 2-[[[2-[[(6S)-9-methyl-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]carbamoyl]-1-benzothiophen-5-yl]methyl-phenoxyphosphanyl]amino]acetate |
| SMILES | CCCOC(=O)CNP(Cc1ccc2sc(C(=O)N[C@H]3CCC(C)CC4CCCN4C3=O)cc2c1)Oc1ccccc1 |
| InChI | InChI=1S/C32H40N3O5PS/c1-3-16-39-30(36)20-33-41(40-26-9-5-4-6-10-26)21-23-12-14-28-24(18-23)19-29(42-28)31(37)34-27-13-11-22(2)17-25-8-7-15-35(25)32(27)38/h4-6,9-10,12,14,18-19,22,25,27,33H,3,7-8,11,13,15-17,20-21H2,1-2H3,(H,34,37)/t22?,25?,27-,41?/m0/s1 |
| InChIKey | LAMVBPPPPWHKOJ-FEGMSOLNSA-N |
| XLogP | 6.24 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|